ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
811-62-1 Dimethylchlorophosphine |
|
| Nom | Dimethylchlorophosphine |
| Nom anglais | Dimethylchlorophosphine;Chlorodimethylphosphine;dimethylphosphinous chloride |
| Formule moléculaire | C2H6ClP |
| Poids Moléculaire | 96.4958 |
| InChl | InChI=1/C2H6ClP/c1-4(2)3/h1-2H3 |
| Numéro de registre CAS | 811-62-1 |
| EINECS | 212-372-3 |
| Structure moléculaire | ![]() |
| Point d'ébullition | 43.6°C at 760 mmHg |
| Pression de vapeur | 387mmHg at 25°C |
| MSDS | |