ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
816-57-9 1-nitroso-1-propylurée |
|
| Nom | 1-nitroso-1-propylurée |
| Synonymes | 1-nitroso-1-propylurée ; propylnitrosourea ; urée, N-nitroso-N-propyl- ; |
| Nom anglais | 1-nitroso-1-propylurea;1-Nitroso-1-propylurea;propylnitrosourea;urea, N-nitroso-N-propyl- |
| Formule moléculaire | C4H9N3O2 |
| Poids Moléculaire | 131.1332 |
| InChl | InChI=1/C4H9N3O2/c1-2-3-7(6-9)4(5)8/h2-3H2,1H3,(H2,5,8) |
| Numéro de registre CAS | 816-57-9 |
| Structure moléculaire | ![]() |
| Densité | 1.27g/cm3 |
| Point d'ébullition | 200.3°C at 760 mmHg |
| Indice de réfraction | 1.524 |
| Point d'éclair | 74.9°C |
| Pression de vapeur | 0.327mmHg at 25°C |
| MSDS | |