ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
824-62-4 Bicyclo[2.2.1]heptane-2-carboxylic Acid |
|
| Nom | Bicyclo[2.2.1]heptane-2-carboxylic Acid |
| Nom anglais | Bicyclo[2.2.1]heptane-2-carboxylic Acid;Norbornane-2-carboxylic acid;(1R,2S,4S)-bicyclo[2.2.1]heptane-2-carboxylate;(1S,2S,4R)-bicyclo[2.2.1]heptane-2-carboxylate |
| Formule moléculaire | C8H11O2 |
| Poids Moléculaire | 139.1723 |
| InChl | InChI=1/C8H12O2/c9-8(10)7-4-5-1-2-6(7)3-5/h5-7H,1-4H2,(H,9,10)/p-1/t5-,6+,7+/m1/s1 |
| Numéro de registre CAS | 824-62-4 |
| EINECS | 212-532-2 |
| Structure moléculaire | ![]() |
| Point d'ébullition | 247.822°C at 760 mmHg |
| Point d'éclair | 113.81°C |
| Pression de vapeur | 0.008mmHg at 25°C |
| Codes des risques | R36/38##Irritating to eyes and skin.:; |
| Description de sécurité | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |