ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
83-13-6 Diethyl phenylmalonate |
|
| Nom | Diethyl phenylmalonate |
| Nom anglais | Diethyl phenylmalonate;Phenylmalonic acid diethyl ester;Phenylpropanedioic acid diethyl ester;phenyl diethyl malonate;Diethyl phenyl malonate; ;diethyl phenylpropanedioate |
| Formule moléculaire | C13H16O4 |
| Poids Moléculaire | 236.2637 |
| InChl | InChI=1/C13H16O4/c1-3-16-12(14)11(13(15)17-4-2)10-8-6-5-7-9-10/h5-9,11H,3-4H2,1-2H3 |
| Numéro de registre CAS | 83-13-6 |
| EINECS | 201-456-5 |
| Structure moléculaire | ![]() |
| Densité | 1.111g/cm3 |
| Point de fusion | 16-17℃ |
| Point d'ébullition | 301°C at 760 mmHg |
| Indice de réfraction | 1.5 |
| Point d'éclair | 141.8°C |
| solubilité dans l'eau | immiscible |
| Pression de vapeur | 0.00108mmHg at 25°C |
| Description de sécurité | S24/25:; |
| MSDS | |