ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
83-69-2 4-amino-3-methyl-1-naphthol |
|
| Nom | 4-amino-3-methyl-1-naphthol |
| Nom anglais | 4-amino-3-methyl-1-naphthol;vitamin K7;4-amino-3-methylnaphthalen-1-ol |
| Formule moléculaire | C11H11NO |
| Poids Moléculaire | 173.2111 |
| InChl | InChI=1/C11H11NO/c1-7-6-10(13)8-4-2-3-5-9(8)11(7)12/h2-6,13H,12H2,1H3 |
| Numéro de registre CAS | 83-69-2 |
| EINECS | 201-495-8 |
| Structure moléculaire | ![]() |
| Densité | 1.232g/cm3 |
| Point d'ébullition | 392°C at 760 mmHg |
| Indice de réfraction | 1.712 |
| Point d'éclair | 190.9°C |
| Pression de vapeur | 1.04E-06mmHg at 25°C |
| MSDS | |