ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
83-75-0 carbonate d’éthylquinine |
|
| Nom | carbonate d’éthylquinine |
| Synonymes | Carbonate d’éthyle de quinine ; carbonate d’éthyle 6'-méthoxycinchonan-9-yle ; carbonate d’éthyle (4beta,8alpha,9R)-6'-méthoxycinchonan-9-yle ; carbonate d’éthyle (9S)-6'-méthoxycinchonan-9-yle ; carbonate d’éthyle (8alpha,9R)-6'-méthoxycinchonan-9-yle ; |
| Nom anglais | ethyl quinine carbonate;Quinine ethylcarbonate;ethyl 6'-methoxycinchonan-9-yl carbonate;ethyl (4beta,8alpha,9R)-6'-methoxycinchonan-9-yl carbonate;ethyl (9S)-6'-methoxycinchonan-9-yl carbonate;ethyl (8alpha,9R)-6'-methoxycinchonan-9-yl carbonate |
| Formule moléculaire | C23H28N2O4 |
| Poids Moléculaire | 396.4794 |
| InChl | InChI=1/C23H28N2O4/c1-4-15-14-25-11-9-16(15)12-21(25)22(29-23(26)28-5-2)18-8-10-24-20-7-6-17(27-3)13-19(18)20/h4,6-8,10,13,15-16,21-22H,1,5,9,11-12,14H2,2-3H3/t15-,16-,21-,22+/m0/s1 |
| Numéro de registre CAS | 83-75-0 |
| EINECS | 201-500-3 |
| Structure moléculaire | ![]() |
| Densité | 1.21g/cm3 |
| Point d'ébullition | 526.3°C at 760 mmHg |
| Indice de réfraction | 1.6 |
| Point d'éclair | 272.1°C |
| Pression de vapeur | 3.63E-11mmHg at 25°C |
| MSDS | |