ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
84-04-8 pipamazine |
|
| Nom | pipamazine |
| Nom anglais | pipamazine;1-(3-(2-chlorophenothiazin-10-yl)propyl)piperidine-4-carboxamide;1-[3-(2-chloro-10H-phenothiazin-10-yl)propyl]piperidine-4-carboxamide |
| Formule moléculaire | C21H24ClN3OS |
| Poids Moléculaire | 401.9528 |
| InChl | InChI=1/C21H24ClN3OS/c22-16-6-7-20-18(14-16)25(17-4-1-2-5-19(17)27-20)11-3-10-24-12-8-15(9-13-24)21(23)26/h1-2,4-7,14-15H,3,8-13H2,(H2,23,26) |
| Numéro de registre CAS | 84-04-8 |
| EINECS | 201-512-9 |
| Structure moléculaire | ![]() |
| Densité | 1.277g/cm3 |
| Point d'ébullition | 626.6°C at 760 mmHg |
| Indice de réfraction | 1.634 |
| Point d'éclair | 332.8°C |
| Pression de vapeur | 1.29E-15mmHg at 25°C |
| MSDS | |