ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
847588-85-6 acide 4-(2,3-dihydro-1H-inden-5-ylamino)-4-oxobutanoïque |
|
| Nom | acide 4-(2,3-dihydro-1H-inden-5-ylamino)-4-oxobutanoïque |
| Synonymes | acide butanoïque, 4-[(2,3-dihydro-1H-inden-5-yl)amino]-4-oxo- ; |
| Nom anglais | 4-(2,3-dihydro-1H-inden-5-ylamino)-4-oxobutanoic acid;butanoic acid, 4-[(2,3-dihydro-1H-inden-5-yl)amino]-4-oxo- |
| Formule moléculaire | C13H15NO3 |
| Poids Moléculaire | 233.2631 |
| InChl | InChI=1/C13H15NO3/c15-12(6-7-13(16)17)14-11-5-4-9-2-1-3-10(9)8-11/h4-5,8H,1-3,6-7H2,(H,14,15)(H,16,17) |
| Numéro de registre CAS | 847588-85-6 |
| Structure moléculaire | ![]() |
| Densité | 1.301g/cm3 |
| Point d'ébullition | 497.9°C at 760 mmHg |
| Indice de réfraction | 1.626 |
| Point d'éclair | 254.9°C |
| Pression de vapeur | 9.82E-11mmHg at 25°C |
| MSDS | |