ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
86-53-3 1-Cyanonaphthalene |
|
| Nom | 1-Cyanonaphthalene |
| Nom anglais | 1-Cyanonaphthalene;Naphthonitrile,98%;NCN;1-Naphthonitrile;Naphthalene-1-carbonitrile;Naphthonitrile;alpha-Naphthylnitrile;1-Naphthaonitrile |
| Formule moléculaire | C11H7N |
| Poids Moléculaire | 153.18 |
| InChl | InChI=1/C11H7N/c12-8-10-6-3-5-9-4-1-2-7-11(9)10/h1-7H |
| Numéro de registre CAS | 86-53-3 |
| EINECS | 201-679-8 |
| Structure moléculaire | ![]() |
| Point de fusion | 36-38℃ |
| Point d'ébullition | 299℃ |
| Les symboles de danger | |
| Codes des risques | R20/21:; |
| Description de sécurité | S23:; |
| MSDS | |