ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
87-39-8 5-hydroxyiminobarbituric acid |
|
| Nom | 5-hydroxyiminobarbituric acid |
| Nom anglais | 5-hydroxyiminobarbituric acid;5-Isonitrosobarbituric acid;2,4,5,6(1H,3H)-Pyrimidinetetrone,5-oxime;Violuric acid;alloxan,5-oxime;violuric acid hydrate;pyrimidine-2,4,5,6(1H,3H)-tetrone 5-oxime |
| Formule moléculaire | C4H3N3O4 |
| Poids Moléculaire | 157.0843 |
| InChl | InChI=1/C4H3N3O4/c8-2-1(7-11)3(9)6-4(10)5-2/h11H,(H2,5,6,8,9,10) |
| Numéro de registre CAS | 87-39-8 |
| EINECS | 201-741-4 |
| Structure moléculaire | ![]() |
| Densité | 2.19g/cm3 |
| Point de fusion | 236-242℃ |
| Point d'ébullition | 494.1°C at 760 mmHg |
| Indice de réfraction | 1.813 |
| Point d'éclair | 252.6°C |
| Pression de vapeur | 7.79E-12mmHg at 25°C |
| MSDS | |