ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
89-18-9 1-[4'-fluoro-3,5-bis(1-méthyléthyl)-6-propylbiphényl-2-yl]éthanol |
|
| Nom | 1-[4'-fluoro-3,5-bis(1-méthyléthyl)-6-propylbiphényl-2-yl]éthanol |
| Synonymes | ; |
| Nom anglais | 1-[4'-fluoro-3,5-bis(1-methylethyl)-6-propylbiphenyl-2-yl]ethanol; |
| Formule moléculaire | C23H31FO |
| Poids Moléculaire | 342.49 |
| InChl | InChI=1/C23H31FO/c1-7-8-19-20(14(2)3)13-21(15(4)5)22(16(6)25)23(19)17-9-11-18(24)12-10-17/h9-16,25H,7-8H2,1-6H3 |
| Numéro de registre CAS | 89-18-9 |
| Structure moléculaire | ![]() |
| Densité | 1.008g/cm3 |
| Point d'ébullition | 446.1°C at 760 mmHg |
| Indice de réfraction | 1.527 |
| Point d'éclair | 267.8°C |
| Pression de vapeur | 9.67E-09mmHg at 25°C |
| MSDS | |