ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
89-30-5 1,4-dibutoxy-2-chloro-5-nitrobenzene |
|
| Nom | 1,4-dibutoxy-2-chloro-5-nitrobenzene |
| Nom anglais | 1,4-dibutoxy-2-chloro-5-nitrobenzene;Benzene, 1,4-dibutoxy-2-chloro-5-nitro-;1,4-Dibutoxy-2-chloro-5-nitrobenzene |
| Formule moléculaire | C14H20ClNO4 |
| Poids Moléculaire | 301.7659 |
| InChl | InChI=1/C14H20ClNO4/c1-3-5-7-19-13-10-12(16(17)18)14(9-11(13)15)20-8-6-4-2/h9-10H,3-8H2,1-2H3 |
| Numéro de registre CAS | 89-30-5 |
| EINECS | 201-896-8 |
| Structure moléculaire | ![]() |
| Densité | 1.159g/cm3 |
| Point d'ébullition | 418°C at 760 mmHg |
| Indice de réfraction | 1.517 |
| Point d'éclair | 206.6°C |
| Pression de vapeur | 8.21E-07mmHg at 25°C |
| MSDS | |