ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
898767-56-1 4-(7-cyanoheptanoyl)benzonitrile |
|
| Nom | 4-(7-cyanoheptanoyl)benzonitrile |
| Nom anglais | 4-(7-cyanoheptanoyl)benzonitrile; |
| Formule moléculaire | C15H16N2O |
| Poids Moléculaire | 240.3003 |
| InChl | InChI=1/C15H16N2O/c16-11-5-3-1-2-4-6-15(18)14-9-7-13(12-17)8-10-14/h7-10H,1-6H2 |
| Numéro de registre CAS | 898767-56-1 |
| Structure moléculaire | ![]() |
| Densité | 1.08g/cm3 |
| Point d'ébullition | 457.3°C at 760 mmHg |
| Indice de réfraction | 1.528 |
| Point d'éclair | 230.4°C |
| Pression de vapeur | 1.51E-08mmHg at 25°C |
| MSDS | |