ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
898786-30-6 4-(5,5-diméthyl-1,3-dioxan-2-yl)-1-(4-nitrophényl)butan-1-one |
|
| Nom | 4-(5,5-diméthyl-1,3-dioxan-2-yl)-1-(4-nitrophényl)butan-1-one |
| Nom anglais | 4-(5,5-dimethyl-1,3-dioxan-2-yl)-1-(4-nitrophenyl)butan-1-one; |
| Formule moléculaire | C16H21NO5 |
| Poids Moléculaire | 307.3416 |
| InChl | InChI=1/C16H21NO5/c1-16(2)10-21-15(22-11-16)5-3-4-14(18)12-6-8-13(9-7-12)17(19)20/h6-9,15H,3-5,10-11H2,1-2H3 |
| Numéro de registre CAS | 898786-30-6 |
| Structure moléculaire | ![]() |
| Densité | 1.143g/cm3 |
| Point d'ébullition | 428.1°C at 760 mmHg |
| Indice de réfraction | 1.515 |
| Point d'éclair | 168.4°C |
| Pression de vapeur | 1.55E-07mmHg at 25°C |
| MSDS | |