ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
1912-43-2 2-methyl-3-indoleacetic acid |
|
| Ονομασία του προϊόντος | 2-methyl-3-indoleacetic acid |
| Αγγλικό όνομα | 2-methyl-3-indoleacetic acid;2-Methylindole-3-acetic acid;(2-methyl-1H-indol-3-yl)acetic acid |
| MF | C11H11NO2 |
| Μοριακό βάρος | 189.2026 |
| InChI | InChI=1/C11H11NO2/c1-7-9(6-11(13)14)8-4-2-3-5-10(8)12-7/h2-5,12H,6H2,1H3,(H,13,14) |
| CAS ΟΧΙ | 1912-43-2 |
| Μοριακή δομή | ![]() |
| Σημείο τήξης | 205℃ |
| Περιγραφή της ασφάλειας | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |