ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54585-47-6 4,6-Dimethyl-2-mercaptonicotinonitrile |
|
| Ονομασία του προϊόντος | 4,6-Dimethyl-2-mercaptonicotinonitrile |
| Αγγλικό όνομα | 4,6-Dimethyl-2-mercaptonicotinonitrile;5-Cyano-6-mercapto-2,4-lutidine~4,6-Dimethyl-2-mercaptonicotinonitrile~4,6-Dimethyl-2-mercaptopyridine-3-carbonitrile;4,6-dimethyl-2-thioxo-1,2-dihydropyridine-3-carbonitrile |
| MF | C8H8N2S |
| Μοριακό βάρος | 164.2275 |
| InChI | InChI=1/C8H8N2S/c1-5-3-6(2)10-8(11)7(5)4-9/h3H,1-2H3,(H,10,11) |
| CAS ΟΧΙ | 54585-47-6 |
| Μοριακή δομή | ![]() |
| Πυκνότητα | 1.21g/cm3 |
| Σημείο βρασμού | 249.8°C at 760 mmHg |
| Δείκτης διάθλασης | 1.608 |
| Σημείο ανάφλεξης | 104.9°C |
| Πίεση ατμών | 0.0225mmHg at 25°C |
| Περιγραφή της ασφάλειας | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |