ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
730-19-8 1-[3-(diethylamino)propyl]-3-phenylthiourea |
|
| Ονομασία του προϊόντος | 1-[3-(diethylamino)propyl]-3-phenylthiourea |
| Αγγλικό όνομα | 1-[3-(diethylamino)propyl]-3-phenylthiourea;1-[3-(Diethylamino)propyl]-3-phenylthiourea;thiourea, N-[3-(diethylamino)propyl]-N'-phenyl- |
| MF | C14H23N3S |
| Μοριακό βάρος | 265.4175 |
| InChI | InChI=1/C14H23N3S/c1-3-17(4-2)12-8-11-15-14(18)16-13-9-6-5-7-10-13/h5-7,9-10H,3-4,8,11-12H2,1-2H3,(H2,15,16,18) |
| CAS ΟΧΙ | 730-19-8 |
| Μοριακή δομή | ![]() |
| Πυκνότητα | 1.081g/cm3 |
| Σημείο βρασμού | 364.9°C at 760 mmHg |
| Δείκτης διάθλασης | 1.59 |
| Σημείο ανάφλεξης | 174.5°C |
| Πίεση ατμών | 1.62E-05mmHg at 25°C |
| MSDS | |