ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
818-03-1 [2-({2-[2-(1-methylethylidene)hydrazino]-2-oxoethyl}amino)-2-oxoethylidene]diazenium (non-preferred name) |
|
| Ονομασία του προϊόντος | [2-({2-[2-(1-methylethylidene)hydrazino]-2-oxoethyl}amino)-2-oxoethylidene]diazenium (non-preferred name) |
| Αγγλικό όνομα | [2-({2-[2-(1-methylethylidene)hydrazino]-2-oxoethyl}amino)-2-oxoethylidene]diazenium (non-preferred name); |
| MF | C7H12N5O2 |
| Μοριακό βάρος | 198.2019 |
| InChI | InChI=1/C7H11N5O2/c1-5(2)11-12-7(14)3-9-6(13)4-10-8/h4,8H,3H2,1-2H3,(H-,9,12,13,14)/p+1 |
| CAS ΟΧΙ | 818-03-1 |
| Μοριακή δομή | ![]() |
| MSDS | |