ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
87-82-1 Hexabromobenzene |
|
| Ονομασία του προϊόντος | Hexabromobenzene |
| Αγγλικό όνομα | Hexabromobenzene;AI3-60220;CCRIS 5917;HSDB 2912;NSC 113975;Benzene, 1,2,3,4,5,6-hexabromo-;Benzene, hexabromo- |
| MF | C6Br6 |
| Μοριακό βάρος | 551.49 |
| InChI | InChI=1/C6Br6/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
| CAS ΟΧΙ | 87-82-1 |
| EINECS | 201-773-9 |
| Μοριακή δομή | ![]() |
| Σημείο τήξης | 326-327℃ |
| Σύμβολα επικινδυνότητας | |
| Κινδύνου Κώδικες | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Περιγραφή της ασφάλειας | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |