ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
106-57-0 Glycine anhydride |
|
| termék neve | Glycine anhydride |
| Angol név | Glycine anhydride;2,5-Diketopiperazine;2,5-Piperazinedione,(Glycine anhydride);Dioxo Piperazine;Cyclo(-Gly-Gly);2,5-Piperazinedione;piperazine-2,5-dione;piperazine-2,3-dione |
| MF | C4H6N2O2 |
| Molekulatömeg | 114.1026 |
| InChI | InChI=1/C4H6N2O2/c7-3-4(8)6-2-1-5-3/h1-2H2,(H,5,7)(H,6,8) |
| CAS-szám | 106-57-0 |
| EINECS | 203-411-5 |
| Molekuláris szerkezete | ![]() |
| Sűrűség | 1.246g/cm3 |
| Olvadáspont | 300℃ |
| Törésmutató | 1.467 |
| Biztonsági Leírás | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |