ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
108-11-2 4-Methyl-2-pentanol |
|
| termék neve | 4-Methyl-2-pentanol |
| Angol név | 4-Methyl-2-pentanol;Isobutyl methyl carbinol;Methyl isobutyl carbinol;methylamyl alcohol;1,3-Dimethyl-1-butanol;1-Methyl-indozole-3-carboxylicacid;2-Methanol-4-pentanol;2-methyl-4-pentano;2-Pentanol,4-methyl-;3-MIC;4-methyl-2-pentano;4-Methyl-2-pentyl alcohol;MIBC;4-methylpentan-2-ol;(2S)-4-methylpentan-2-ol;(2R)-4-methylpentan-2-ol;Methyl amyl alcohol |
| MF | C6H14O |
| Molekulatömeg | 102.1748 |
| InChI | InChI=1/C6H14O/c1-5(2)4-6(3)7/h5-7H,4H2,1-3H3/t6-/m1/s1 |
| CAS-szám | 108-11-2 |
| EINECS | 203-551-7 |
| Molekuláris szerkezete | ![]() |
| Sűrűség | 0.811g/cm3 |
| Olvadáspont | -90℃ |
| Forráspont | 133.5°C at 760 mmHg |
| Törésmutató | 1.411 |
| Gyulladáspont | 41.1°C |
| Vízben való oldhatóság | 2 g/100 mL |
| Gőznyomás | 3.68mmHg at 25°C |
| Veszély szimbólumok | |
| Kockázatot kódok | R10||R37:; |
| Biztonsági Leírás | S24/25:; |
| MSDS | |