ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
1892-57-5 N-(3-dimethylaminopropyl)-N'-ethyl-carbodiimide |
|
termék neve | N-(3-dimethylaminopropyl)-N'-ethyl-carbodiimide |
Angol név | N-(3-dimethylaminopropyl)-N'-ethyl-carbodiimide;1-(3-dimethylaminopropyl)-N-ethylcarbodiimide;1-(3-Dimethylaminopropyl)-3-ethylcarbodiimide |
MF | C8H17N3 |
Molekulatömeg | 155.2407 |
InChI | InChI=1/C8H17N3/c1-4-9-8-10-6-5-7-11(2)3/h4-7H2,1-3H3 |
CAS-szám | 1892-57-5 |
EINECS | 217-579-2 |
Molekuláris szerkezete | ![]() |
Sűrűség | 0.86g/cm3 |
Forráspont | 197.7°C at 760 mmHg |
Törésmutató | 1.459 |
Gyulladáspont | 73.4°C |
Gőznyomás | 0.373mmHg at 25°C |
Veszély szimbólumok | |
Kockázatot kódok | R22##Harmful if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.||R42/43##May cause sensitization by inhalation and skin contact.:; |
Biztonsági Leírás | S23##Do not inhale gas/fumes/vapour/spray.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |