ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
3125-64-2 3-Methoxyphenyl isothiocyanate |
|
termék neve | 3-Methoxyphenyl isothiocyanate |
Angol név | 3-Methoxyphenyl isothiocyanate;m-Anisyl isothiocyanate;3-(Isothiocyanato)-anisole |
MF | C8H7NOS |
Molekulatömeg | 165.20 |
InChI | InChI=1/C8H7NOS/c1-10-8-4-2-3-7(5-8)9-6-11/h2-5H,1H3 |
CAS-szám | 3125-64-2 |
Molekuláris szerkezete | ![]() |
Sűrűség | 1.179 |
Forráspont | 133℃(10 torr) |
Kockázatot kódok | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R34##Causes burns.:; |
Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |