ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
491-54-3 4'-Methoxy-3,5,7-trihydroxyflavone |
|
termék neve | 4'-Methoxy-3,5,7-trihydroxyflavone |
Angol név | 4'-Methoxy-3,5,7-trihydroxyflavone;Kaempferide;3,5,7-Trihydroxy-4-methoxyflavone;3,5,7-trihydroxy-2-(4-methoxyphenyl)-4H-chromen-4-one |
MF | C16H12O6 |
Molekulatömeg | 300.2629 |
InChI | InChI=1/C16H12O6/c1-21-10-4-2-8(3-5-10)16-15(20)14(19)13-11(18)6-9(17)7-12(13)22-16/h2-7,17-18,20H,1H3 |
CAS-szám | 491-54-3 |
EINECS | 207-738-4 |
Molekuláris szerkezete | ![]() |
Sűrűség | 1.538g/cm3 |
Forráspont | 543.8°C at 760 mmHg |
Törésmutató | 1.709 |
Gyulladáspont | 207.1°C |
Gőznyomás | 1.94E-12mmHg at 25°C |
Kockázatot kódok | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |