ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
504-08-5 2,4-Diamino-s-triazin |
|
| termék neve | 2,4-Diamino-s-triazin |
| Szinonimák | ;D iaminotriazin; 1,3,5-triazin-2,4-diamin; 2,4-diamino-1,3,5-triazin; |
| Angol név | 2,4-Diamino-s-triazine;Diaminotriazine;1,3,5-triazine-2,4-diamine;2,4-Diamino-1,3,5-Triazine |
| MF | C3H5N5 |
| Molekulatömeg | 111.1053 |
| InChI | InChI=1/C3H5N5/c4-2-6-1-7-3(5)8-2/h1H,(H4,4,5,6,7,8) |
| CAS-szám | 504-08-5 |
| EINECS | 207-983-7 |
| Molekuláris szerkezete | ![]() |
| Sűrűség | 1.508g/cm3 |
| Forráspont | 447.6°C at 760 mmHg |
| Törésmutató | 1.716 |
| Gyulladáspont | 254.9°C |
| Gőznyomás | 3.32E-08mmHg at 25°C |
| Kockázatot kódok | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |