ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
51839-50-0 4-[(4-aminophenyl)methyl]-2-ethylaniline |
|
| termék neve | 4-[(4-aminophenyl)methyl]-2-ethylaniline |
| Angol név | 4-[(4-aminophenyl)methyl]-2-ethylaniline;4-((4-Aminophenyl)methyl)-2-ethylaniline;Benzenamine, 4-((4-aminophenyl)methyl)-2-ethyl-;Benzeneamine, 4-((4-aminophenyl)methyl)-2-ethyl-;4-(4-aminobenzyl)-2-ethylaniline |
| MF | C15H18N2 |
| Molekulatömeg | 226.3168 |
| InChI | InChI=1/C15H18N2/c1-2-13-10-12(5-8-15(13)17)9-11-3-6-14(16)7-4-11/h3-8,10H,2,9,16-17H2,1H3 |
| CAS-szám | 51839-50-0 |
| EINECS | 257-468-6 |
| Molekuláris szerkezete | ![]() |
| Sűrűség | 1.097g/cm3 |
| Forráspont | 406.6°C at 760 mmHg |
| Törésmutató | 1.632 |
| Gyulladáspont | 238.9°C |
| Gőznyomás | 8.04E-07mmHg at 25°C |
| MSDS | |