ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
82-99-5 tifenamil |
|
| termék neve | tifenamil |
| Angol név | tifenamil;Tifenamil [INN];Thiphenamil;Thiphenum;Tifenamil;Tifenamilo;Tifenamilo [INN-Spanish];Tifenamilum;Tifenamilum [INN-Latin];UNII-GX4D5197DT;Benzeneethanethioic acid, alpha-phenyl-, S-(2-(diethylamino)ethyl) ester;S-[2-(diethylamino)ethyl] diphenylethanethioate |
| MF | C20H25NOS |
| Molekulatömeg | 327.4836 |
| InChI | InChI=1/C20H25NOS/c1-3-21(4-2)15-16-23-20(22)19(17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14,19H,3-4,15-16H2,1-2H3 |
| CAS-szám | 82-99-5 |
| Molekuláris szerkezete | ![]() |
| Sűrűség | 1.079g/cm3 |
| Forráspont | 441.8°C at 760 mmHg |
| Törésmutató | 1.571 |
| Gyulladáspont | 221°C |
| Gőznyomás | 5.27E-08mmHg at 25°C |
| MSDS | |