ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
84-69-5 Diisobutyl phthalate |
|
| termék neve | Diisobutyl phthalate |
| Angol név | Diisobutyl phthalate;DIBP;1,2-benzenedicarboxylic acid bis(2-methylpropyl) ester;phthalic acid diisobutyl ester;3,4-bis(2-methylpropyl)benzene-1,2-dicarboxylate;1,2-Benzenedicarboxylicacid,1,2-bis(2-methylpropyl)ester |
| MF | C16H20O4 |
| Molekulatömeg | 276.3287 |
| InChI | InChI=1/C16H22O4/c1-9(2)7-11-5-6-12(15(17)18)14(16(19)20)13(11)8-10(3)4/h5-6,9-10H,7-8H2,1-4H3,(H,17,18)(H,19,20)/p-2 |
| CAS-szám | 84-69-5 |
| EINECS | 201-553-2 |
| Molekuláris szerkezete | ![]() |
| Olvadáspont | -64℃ |
| Forráspont | 413.986°C at 760 mmHg |
| Gyulladáspont | 218.323°C |
| Vízben való oldhatóság | Insoluble |
| Gőznyomás | 0mmHg at 25°C |
| Veszély szimbólumok | |
| Kockázatot kódok | R50/53||R62||R63:; |
| Biztonsági Leírás | S36/37||S61:; |
| MSDS | |