ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
86-29-3 Diphenylacetonitrile |
|
| termék neve | Diphenylacetonitrile |
| Angol név | Diphenylacetonitrile;Benzeneacetonitrile, alpha-phenyl-;benzhydryl cyanide;Dipan;Diphenatrile; |
| MF | C14H11N |
| Molekulatömeg | 193.2438 |
| InChI | InChI=1/C14H11N/c15-11-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,14H |
| CAS-szám | 86-29-3 |
| EINECS | 201-662-5 |
| Molekuláris szerkezete | ![]() |
| Sűrűség | 1.076g/cm3 |
| Olvadáspont | 71-73℃ |
| Forráspont | 322.3°C at 760 mmHg |
| Törésmutató | 1.584 |
| Gyulladáspont | 151.6°C |
| Vízben való oldhatóság | INSOLUBLE |
| Gőznyomás | 0.000282mmHg at 25°C |
| Veszély szimbólumok | |
| Kockázatot kódok | R36/37/38:; |
| Biztonsági Leírás | S26||S37/39:; |
| MSDS | |