ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
87-83-2 pentabromotoluene |
|
| termék neve | pentabromotoluene |
| Angol név | pentabromotoluene;2,3,4,5,6-Pentabromotoluene;Benzene, pentabromomethyl-;CCRIS 4854;Flammex 5bt;HSDB 5253;Pentabromomethylbenzene;Pentabromotoluene;Toluene, 2,3,4,5,6-pentabromo-;Benzene, 1,2,3,4,5-pentabromo-6-methyl-;1,2,3,4,5-pentabromo-6-methylbenzene |
| MF | C7H3Br5 |
| Molekulatömeg | 486.6187 |
| InChI | InChI=1/C7H3Br5/c1-2-3(8)5(10)7(12)6(11)4(2)9/h1H3 |
| CAS-szám | 87-83-2 |
| EINECS | 201-774-4 |
| Molekuláris szerkezete | ![]() |
| Sűrűség | 2.607g/cm3 |
| Forráspont | 394.4°C at 760 mmHg |
| Törésmutató | 1.667 |
| Gyulladáspont | 186.5°C |
| Gőznyomás | 4.5E-06mmHg at 25°C |
| MSDS | |