ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
883194-97-6 4-(4-fenilpiperazin-1-il)ciklohexanamin |
|
| termék neve | 4-(4-fenilpiperazin-1-il)ciklohexanamin |
| Szinonimák | ; cisz-4-(4-fenilpiperazin-1-il)ciklohexanamin; cisz-4-(4-fenilpiperazin-1-il)ciklohexánamin |
| Angol név | 4-(4-phenylpiperazin-1-yl)cyclohexanamine;cis-4-(4-Phenylpiperazin-1-yl)cyclohexanamin;cis-4-(4-phenylpiperazin-1-yl)cyclohexanamine |
| MF | C16H25N3 |
| Molekulatömeg | 259.39 |
| InChI | InChI=1/C16H25N3/c17-14-6-8-16(9-7-14)19-12-10-18(11-13-19)15-4-2-1-3-5-15/h1-5,14,16H,6-13,17H2/t14-,16+ |
| CAS-szám | 883194-97-6 |
| Molekuláris szerkezete | ![]() |
| Sűrűség | 1.078g/cm3 |
| Forráspont | 392.7°C at 760 mmHg |
| Törésmutató | 1.573 |
| Gyulladáspont | 188.4°C |
| Gőznyomás | 2.25E-06mmHg at 25°C |
| MSDS | |