ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
1119-40-0 Dimethyl glutarate |
|
| Nama produk | Dimethyl glutarate |
| Nama bahasa Inggris | Dimethyl glutarate;dbe-5 dibasic ester;Glutaric acid dimethyl ester;Pentanedioic acid dimethyl ester;DIMETHYLE GLUTARATE;DBE-2;dimethyl pentanedioate;dimethyl glutamate;5-methoxy-4-methyl-1H-indole |
| MF | C10H11NO |
| Berat Molekul | 161.2004 |
| InChI | InChI=1/C10H11NO/c1-7-8-5-6-11-9(8)3-4-10(7)12-2/h3-6,11H,1-2H3 |
| CAS NO | 1119-40-0 |
| EINECS | 214-277-2 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.134g/cm3 |
| Titik lebur | -37℃ |
| Titik didih | 303.3°C at 760 mmHg |
| Indeks bias | 1.621 |
| Titik nyala | 111.2°C |
| Kelarutan air | 53 g/L |
| Tekanan uap | 0.00168mmHg at 25°C |
| Simbol bahaya | |
| Kode Risiko | R36/37/38:; |
| Keselamatan Deskripsi | S26||S36:; |
| MSDS | |