ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
121247-01-6 3-Fluorophenylglyoxal hydrate |
|
Nama produk | 3-Fluorophenylglyoxal hydrate |
Nama bahasa Inggris | 3-Fluorophenylglyoxal hydrate;(3-fluorophenyl)(oxo)acetaldehyde hydrate |
MF | C8H7FO3 |
Berat Molekul | 170.1378 |
InChI | InChI=1/C8H5FO2.H2O/c9-7-3-1-2-6(4-7)8(11)5-10;/h1-5H;1H2 |
CAS NO | 121247-01-6 |
Struktur Molekul | ![]() |
Titik didih | 213.4°C at 760 mmHg |
Titik nyala | 80°C |
Tekanan uap | 0.164mmHg at 25°C |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |