ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
206761-68-4 2-Methoxybiphenyl 3-isothiocyanate |
|
| Nama produk | 2-Methoxybiphenyl 3-isothiocyanate |
| Nama bahasa Inggris | 2-Methoxybiphenyl 3-isothiocyanate;1,1'-Biphenyl, 3-isothiocyanato-4-methoxy-;3-Isothiocyanato-4-methoxy-1,1'-biphenyl;3-Isothiocyanato-4-methoxybiphenyl;3-Isothiocyanatobiphenyl-4-yl methyl ether |
| MF | C14H11NOS |
| Berat Molekul | 241.3082 |
| InChI | InChI=1/C14H11NOS/c1-16-14-8-7-12(9-13(14)15-10-17)11-5-3-2-4-6-11/h2-9H,1H3 |
| CAS NO | 206761-68-4 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.09g/cm3 |
| Titik didih | 419.7°C at 760 mmHg |
| Indeks bias | 1.583 |
| Titik nyala | 207.6°C |
| Tekanan uap | 7.26E-07mmHg at 25°C |
| MSDS | |