ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
27194-74-7 lauric acid, monoester with propane-1,2-diol |
|
Nama produk | lauric acid, monoester with propane-1,2-diol |
Nama bahasa Inggris | lauric acid, monoester with propane-1,2-diol;BPML;2-hydroxypropyl laurate;2-hydroxypropyl dodecanoate;1-hydroxypropan-2-yl dodecanoate |
MF | C15H30O3 |
Berat Molekul | 258.3969 |
InChI | InChI=1/C15H30O3/c1-3-4-5-6-7-8-9-10-11-12-15(17)18-14(2)13-16/h14,16H,3-13H2,1-2H3 |
CAS NO | 27194-74-7;142-55-2 |
EINECS | 248-315-4 |
Struktur Molekul | ![]() |
Kepadatan | 0.931g/cm3 |
Titik didih | 362.5°C at 760 mmHg |
Indeks bias | 1.451 |
Titik nyala | 139.3°C |
Tekanan uap | 1.01E-06mmHg at 25°C |
MSDS |