ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
2768-42-5 (R)-(+)-3-Hydroxy-3-phenylpropionic acid |
|
| Nama produk | (R)-(+)-3-Hydroxy-3-phenylpropionic acid |
| Nama bahasa Inggris | (R)-(+)-3-Hydroxy-3-phenylpropionic acid;(3R)-3-hydroxy-3-phenylpropanoate;(3R)-3-hydroxy-3-phenylpropanoic acid |
| MF | C9H10O3 |
| Berat Molekul | 166.1739 |
| InChI | InChI=1/C9H10O3/c10-8(6-9(11)12)7-4-2-1-3-5-7/h1-5,8,10H,6H2,(H,11,12)/t8-/m1/s1 |
| CAS NO | 2768-42-5 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.262g/cm3 |
| Titik didih | 329.4°C at 760 mmHg |
| Indeks bias | 1.575 |
| Titik nyala | 167.2°C |
| Tekanan uap | 7.14E-05mmHg at 25°C |
| Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |