ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
368869-96-9 3- (4-bromofenoksi) -6-methylpyridazine |
|
Nama produk | 3- (4-bromofenoksi) -6-methylpyridazine |
Sinonim | ; Etil 4-bromo-3,5-dimetil-1H-pirol-2-karboksilat; |
Nama bahasa Inggris | 3-(4-bromophenoxy)-6-methylpyridazine;Ethyl 4-bromo-3,5-dimethyl-1H-pyrrole-2-carboxylate |
MF | C11H9BrN2O |
Berat Molekul | 265.106 |
InChI | InChI=1/C11H9BrN2O/c1-8-2-7-11(14-13-8)15-10-5-3-9(12)4-6-10/h2-7H,1H3 |
CAS NO | 368869-96-9 |
Struktur Molekul | ![]() |
Kepadatan | 1.481g/cm3 |
Titik lebur | 145℃ |
Titik didih | 387.6°C at 760 mmHg |
Indeks bias | 1.602 |
Titik nyala | 188.2°C |
Tekanan uap | 7.26E-06mmHg at 25°C |
Simbol bahaya | |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |