ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
446-09-3 2-Bromo-5-fluoronitrobenzene |
|
| Nama produk | 2-Bromo-5-fluoronitrobenzene |
| Nama bahasa Inggris | 2-Bromo-5-fluoronitrobenzene;1-Bromo-4-fluoro-2-nitrobenzene |
| MF | C6H3BrFNO2 |
| Berat Molekul | 219.9959 |
| InChI | InChI=1/C6H3BrFNO2/c7-5-2-1-4(8)3-6(5)9(10)11/h1-3H |
| CAS NO | 446-09-3 |
| EINECS | 207-160-2 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.808g/cm3 |
| Titik lebur | 37-39℃ |
| Titik didih | 220.9°C at 760 mmHg |
| Indeks bias | 1.579 |
| Titik nyala | 87.4°C |
| Tekanan uap | 0.164mmHg at 25°C |
| Kode Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |