ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
50907-46-5 5-(2-Chlorophenyl)-1H-tetrazole |
|
| Nama produk | 5-(2-Chlorophenyl)-1H-tetrazole |
| Nama bahasa Inggris | 5-(2-Chlorophenyl)-1H-tetrazole;5-(2-chlorophenyl)-2H-tetrazole |
| MF | C7H5ClN4 |
| Berat Molekul | 180.5944 |
| InChI | InChI=1/C7H5ClN4/c8-6-4-2-1-3-5(6)7-9-11-12-10-7/h1-4H,(H,9,10,11,12) |
| CAS NO | 50907-46-5 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.448g/cm3 |
| Titik didih | 367.5°C at 760 mmHg |
| Indeks bias | 1.631 |
| Titik nyala | 207.6°C |
| Tekanan uap | 1.36E-05mmHg at 25°C |
| Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |