ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
513-86-0 Acetyl methyl carbinol |
|
| Nama produk | Acetyl methyl carbinol |
| Nama bahasa Inggris | Acetyl methyl carbinol;3-Hydroxy-2-butanone;acetoin, mixture of monomer and dimer;Acetoin (3-Hydroxy-2-butanone);1-acetylethanol;Acetoin;3-hydroxybutan-2-one;(3R)-3-hydroxybutan-2-one;(3S)-3-hydroxybutan-2-one;Acetoion;Acetion |
| MF | C4H8O2 |
| Berat Molekul | 88.1051 |
| InChI | InChI=1/C4H8O2/c1-3(5)4(2)6/h3,5H,1-2H3/t3-/m0/s1 |
| CAS NO | 513-86-0 |
| EINECS | 208-174-1 |
| Struktur Molekul | ![]() |
| Kepadatan | 0.983g/cm3 |
| Titik lebur | 15℃ |
| Titik didih | 145.4°C at 760 mmHg |
| Indeks bias | 1.408 |
| Titik nyala | 49.7°C |
| Kelarutan air | SOLUBLE |
| Tekanan uap | 1.92mmHg at 25°C |
| Simbol bahaya | |
| Kode Risiko | R10||R36/38:; |
| Keselamatan Deskripsi | S26||S36/37:; |
| MSDS | |