ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
51305-67-0 3,4-dichloro-N-[(E)-thiophen-2-ylmethylidene]aniline |
|
| Nama produk | 3,4-dichloro-N-[(E)-thiophen-2-ylmethylidene]aniline |
| Nama bahasa Inggris | 3,4-dichloro-N-[(E)-thiophen-2-ylmethylidene]aniline;3,4-Dichloro-N-[(E)-2-thienylmethylene]aniline;benzenamine, 3,4-dichloro-N-[(1E)-2-thienylmethylene]- |
| MF | C11H7Cl2NS |
| Berat Molekul | 256.151 |
| InChI | InChI=1/C11H7Cl2NS/c12-10-4-3-8(6-11(10)13)14-7-9-2-1-5-15-9/h1-7H/b14-7+ |
| CAS NO | 51305-67-0 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.34g/cm3 |
| Titik didih | 398.4°C at 760 mmHg |
| Indeks bias | 1.635 |
| Titik nyala | 194.8°C |
| Tekanan uap | 3.4E-06mmHg at 25°C |
| MSDS | |