ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52469-00-8 4-tert-butylphenol: formaldehida: 4-fenilfenol |
|
| Nama produk | 4-tert-butylphenol: formaldehida: 4-fenilfenol |
| Sinonim | ; |
| Nama bahasa Inggris | 4-tert-butylphenol: formaldehyde: 4-phenylphenol; |
| MF | C23H26O3 |
| Berat Molekul | 350.4507 |
| InChI | InChI=1/C12H10O.C10H14O.CH2O/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10;1-10(2,3)8-4-6-9(11)7-5-8;1-2/h1-9,13H;4-7,11H,1-3H3;1H2 |
| CAS NO | 52469-00-8;80112-43-2 |
| Struktur Molekul | ![]() |
| Titik didih | 306.4°C at 760 mmHg |
| Titik nyala | 147.2°C |
| Tekanan uap | 0.000428mmHg at 25°C |
| MSDS | |