ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52502-66-6 4,5-Diamino-6-hydroxypyrimidine sulfate |
|
| Nama produk | 4,5-Diamino-6-hydroxypyrimidine sulfate |
| Nama bahasa Inggris | 4,5-Diamino-6-hydroxypyrimidine sulfate;5,6-Diamino-4-pyrimidinol sulfate;4,5-diamino-6-hyroxypyrimidine sulfate;5,6-diaminopyrimidin-4(1H)-one sulfate (1:1) |
| MF | C4H8N4O6S |
| Berat Molekul | 240.1945 |
| InChI | InChI=1/C4H6N4O2.H2O4S/c5-1-2(9)7-4(6)8-3(1)10;1-5(2,3)4/h5H2,(H4,6,7,8,9,10);(H2,1,2,3,4) |
| CAS NO | 52502-66-6 |
| EINECS | 257-971-0 |
| Struktur Molekul | ![]() |
| Titik lebur | 270℃ |
| Keselamatan Deskripsi | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |