ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54376-65-7 4-Diethylaminobenzaldehyde oxime |
|
| Nama produk | 4-Diethylaminobenzaldehyde oxime |
| Nama bahasa Inggris | 4-Diethylaminobenzaldehyde oxime;4-Diethylaminobenzaldoxime |
| MF | C11H16N2O |
| Berat Molekul | 192.2575 |
| InChI | InChI=1/C11H16N2O/c1-3-13(4-2)11-7-5-10(6-8-11)9-12-14/h5-9,14H,3-4H2,1-2H3/b12-9+ |
| CAS NO | 54376-65-7 |
| Struktur Molekul | ![]() |
| Kepadatan | 1g/cm3 |
| Titik didih | 307.7°C at 760 mmHg |
| Indeks bias | 1.517 |
| Titik nyala | 139.9°C |
| Tekanan uap | 0.000309mmHg at 25°C |
| Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |