ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
56-53-1 Diethylstilbestrol |
|
| Nama produk | Diethylstilbestrol |
| Nama bahasa Inggris | Diethylstilbestrol;Stilboestrol;a,a-Diethyl-4,4-Stilbenediol Carc.;Atovaquone;4,4'-(3E)-hex-3-ene-3,4-diyldiphenol;4,4'-(3Z)-hex-3-ene-3,4-diyldiphenol;diethylstilbestrol, mixture of cis and trans;Diethylstilbestrol,mixture of cis and trans;Diethylstilbestrol BP |
| MF | C18H20O2 |
| Berat Molekul | 268.3502 |
| InChI | InChI=1/C18H20O2/c1-3-17(13-5-9-15(19)10-6-13)18(4-2)14-7-11-16(20)12-8-14/h5-12,19-20H,3-4H2,1-2H3/b18-17- |
| CAS NO | 56-53-1;6898-97-1 |
| EINECS | 200-278-5 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.107g/cm3 |
| Titik lebur | 169-175℃ |
| Titik didih | 407.1°C at 760 mmHg |
| Indeks bias | 1.603 |
| Titik nyala | 187°C |
| Kelarutan air | PRACTICALLY INSOLUBLE |
| Tekanan uap | 3.29E-07mmHg at 25°C |
| Simbol bahaya | |
| Kode Risiko | R40||R45||R61||R36/37/38||R51/53:; |
| Keselamatan Deskripsi | S36/37/39||S45||S53||S60||S61:; |
| MSDS | |