ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
59748-37-7 4'-pentylbiphenyl-4-carbonyl chloride |
|
| Nama produk | 4'-pentylbiphenyl-4-carbonyl chloride |
| Nama bahasa Inggris | 4'-pentylbiphenyl-4-carbonyl chloride;(1,1'-Biphenyl)-4-carbonyl chloride, 4'-pentyl-;[1,1'-biphenyl]-4-carbonyl chloride, 4'-pentyl-;4'-Pentylbiphenyl-4-carbonyl chloride;p-Pentylbiphenyl-p'-carbonyl chloride |
| MF | C18H19ClO |
| Berat Molekul | 286.7959 |
| InChI | InChI=1/C18H19ClO/c1-2-3-4-5-14-6-8-15(9-7-14)16-10-12-17(13-11-16)18(19)20/h6-13H,2-5H2,1H3 |
| CAS NO | 59748-37-7 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.088g/cm3 |
| Titik didih | 401.3°C at 760 mmHg |
| Indeks bias | 1.554 |
| Titik nyala | 195.5°C |
| Tekanan uap | 1.19E-06mmHg at 25°C |
| MSDS | |