ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
704-38-1 Bis(2-thienyl) ketone |
|
| Nama produk | Bis(2-thienyl) ketone |
| Nama bahasa Inggris | Bis(2-thienyl) ketone;Di-2-thienyl ketone;Bis(2-thienyl)ketone~Di-2-thienyl ketone;dithiophen-2-ylmethanone |
| MF | C9H6OS2 |
| Berat Molekul | 194.2733 |
| InChI | InChI=1/C9H6OS2/c10-9(7-3-1-5-11-7)8-4-2-6-12-8/h1-6H |
| CAS NO | 704-38-1 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.326g/cm3 |
| Titik lebur | 89-91℃ |
| Titik didih | 323°C at 760 mmHg |
| Indeks bias | 1.64 |
| Titik nyala | 149.1°C |
| Tekanan uap | 0.00027mmHg at 25°C |
| Keselamatan Deskripsi | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |