ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
81-71-0 4,4'-(2-klorobenziliden)di-2,5-xilidin |
|
| Nama produk | 4,4'-(2-klorobenziliden)di-2,5-xilidin |
| Sinonim | Benzenamin, 4,4'-((2-klorofenil)metilen)bis(2,5-dimetil-; 4,4'-(2-Chlorobenzylidene)di-2,5-xilidin; 4,4'-[(2-klorofenil)metanadiil]bis(2,5-dimetilanilin); |
| Nama bahasa Inggris | 4,4'-(2-chlorobenzylidene)di-2,5-xylidine;Benzenamine, 4,4'-((2-chlorophenyl)methylene)bis(2,5-dimethyl-;4,4'-(2-Chlorobenzylidene)di-2,5-xylidine;4,4'-[(2-chlorophenyl)methanediyl]bis(2,5-dimethylaniline) |
| MF | C23H25ClN2 |
| Berat Molekul | 364.911 |
| InChI | InChI=1/C23H25ClN2/c1-13-11-21(25)15(3)9-18(13)23(17-7-5-6-8-20(17)24)19-10-16(4)22(26)12-14(19)2/h5-12,23H,25-26H2,1-4H3 |
| CAS NO | 81-71-0 |
| EINECS | 201-372-9 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.161g/cm3 |
| Titik didih | 535°C at 760 mmHg |
| Indeks bias | 1.635 |
| Titik nyala | 277.4°C |
| Tekanan uap | 1.6E-11mmHg at 25°C |
| MSDS | |