ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
81-84-5 1,8-Naphthalic anhydride |
|
| Nama produk | 1,8-Naphthalic anhydride |
| Nama bahasa Inggris | 1,8-Naphthalic anhydride; |
| MF | C12H6O3 |
| Berat Molekul | 198.17 |
| InChI | InChI=1S/C12H6O3/c13-11-8-5-1-3-7-4-2-6-9(10(7)8)12(14)15-11/h1-6H |
| CAS NO | 81-84-5 |
| EINECS | 201-380-2 |
| Struktur Molekul | ![]() |
| Titik lebur | 267-269℃ |
| Indeks bias | 1.736 |
| Titik nyala | 272℃ |
| Kelarutan air | decomposes |
| Keselamatan Deskripsi | S24/25:; |
| MSDS | |