ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
816-40-0 1-bromo-2-butanone |
|
Nama produk | 1-bromo-2-butanone |
Nama bahasa Inggris | 1-bromo-2-butanone;Bromomethyl ethyl ketone;1-bromobutan-2-one |
MF | C4H7BrO |
Berat Molekul | 151.0018 |
InChI | InChI=1/C4H7BrO/c1-2-4(6)3-5/h2-3H2,1H3 |
CAS NO | 816-40-0 |
EINECS | 212-431-3 |
Struktur Molekul | ![]() |
Kepadatan | 1.439g/cm3 |
Titik didih | 155.9°C at 760 mmHg |
Indeks bias | 1.452 |
Titik nyala | 68.3°C |
Tekanan uap | 2.96mmHg at 25°C |
Kode Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |